2-[2-(2-Methylpiperidino)ethoxy]ethyl=benzoate structure
|
Common Name | 2-[2-(2-Methylpiperidino)ethoxy]ethyl=benzoate | ||
|---|---|---|---|---|
| CAS Number | 64050-31-3 | Molecular Weight | 291.38500 | |
| Density | 1.052g/cm3 | Boiling Point | 368.4ºC at 760mmHg | |
| Molecular Formula | C17H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | 2-[2-(2-methylpiperidin-1-yl)ethoxy]ethyl benzoate |
|---|
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760mmHg |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.38500 |
| Flash Point | 176.6ºC |
| Exact Mass | 291.18300 |
| PSA | 38.77000 |
| LogP | 2.67230 |
| Index of Refraction | 1.511 |
| InChIKey | HKCCFWTYDQUANZ-UHFFFAOYSA-N |
| SMILES | CC1CCCCN1CCOCCOC(=O)c1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
2-[2-(2-Methylp... CAS#:64050-31-3 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
|
~%
2-[2-(2-Methylp... CAS#:64050-31-3 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |