Phosphoric acid dimethyl 1,2-dichloro-2,2-dibromoethyl ester structure
|
Common Name | Phosphoric acid dimethyl 1,2-dichloro-2,2-dibromoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 64050-72-2 | Molecular Weight | 380.78400 | |
| Density | 2.032g/cm3 | Boiling Point | 279.9ºC at 760mmHg | |
| Molecular Formula | C4H7Br2Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.1ºC | |
| Name | (2,2-dibromo-1,2-dichloroethyl) dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.032g/cm3 |
|---|---|
| Boiling Point | 279.9ºC at 760mmHg |
| Molecular Formula | C4H7Br2Cl2O4P |
| Molecular Weight | 380.78400 |
| Flash Point | 123.1ºC |
| Exact Mass | 377.78300 |
| PSA | 54.57000 |
| LogP | 3.65120 |
| Index of Refraction | 1.528 |
| InChIKey | BAVBTSMRGZYBOQ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)OC(Cl)C(Cl)(Br)Br |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phosphoric acid 2,2-dibromo-1,2-dichloro-ethyl ester dimethyl ester |
| 2,2-dibromo-1,2-dichloroethyldimethyl phosphate |
| Phosphoric acid,2,2-dibromo-1,2-dichloroethyl dimethyl ester |