di-9-octadecenyl hydrogen phosphate
Modify Date: 2025-11-28 10:15:21
di-9-octadecenyl hydrogen phosphate structure
|
Common Name | di-9-octadecenyl hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 64051-27-0 | Molecular Weight | 598.92000 | |
| Density | 0.929g/cm3 | Boiling Point | 651.4ºC at 760 mmHg | |
| Molecular Formula | C36H71O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.7ºC | |
| Name | bis[(E)-octadec-9-enyl] hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 651.4ºC at 760 mmHg |
| Molecular Formula | C36H71O4P |
| Molecular Weight | 598.92000 |
| Flash Point | 347.7ºC |
| Exact Mass | 598.50900 |
| PSA | 65.57000 |
| LogP | 13.19500 |
| Index of Refraction | 1.473 |
| InChIKey | WFFZELZOEWLYNK-XPWSMXQVSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCCOP(=O)(O)OCCCCCCCCC=CCCCCCCCC |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 9-Octadecen-1-ol,hydrogen phosphate |
| Di-9-octadecenyl hydrogen phosphate |
| phosphoric acid di-octadec-9-enyl ester |
| EINECS 264-625-2 |