1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
Modify Date: 2026-09-27 18:40:16
1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide structure
|
Common Name | 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 64054-27-9 | Molecular Weight | 258.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N4O5 |
|---|---|
| Molecular Weight | 258.23 |
| InChIKey | YTWBEAIGNOIYFM-MWKIOEHESA-N |
| SMILES | COC1C(O)C(CO)OC1n1cnc(C(N)=O)n1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 7, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: Molecular formula of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is C9H14N4O5. |
| Q: What is the InChIKey of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: InChIKey of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is YTWBEAIGNOIYFM-MWKIOEHESA-N. |
| Q: What is the SMILES notation of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: SMILES notation of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is COC1C(O)C(CO)OC1n1cnc(C(N)=O)n1. |
| Q: What is the molecular weight of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: Molecular weight of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is 258.23. |
| Q: What is the English name of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: The English name of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide. |
| Q: What is the CAS number of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide? |
| A: CAS number of 1-(2-O-Methyl-I(2)-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is 64054-27-9. |
| Q: What is the Chinese name of 64054-27-9? |
| A: Chinese name of 64054-27-9 is 64054-27-9. |