3-Acetylaminodibenzothiophene
Modify Date: 2025-10-04 19:04:29
3-Acetylaminodibenzothiophene structure
|
Common Name | 3-Acetylaminodibenzothiophene | ||
|---|---|---|---|---|
| CAS Number | 64057-52-9 | Molecular Weight | 241.30800 | |
| Density | 1.338g/cm3 | Boiling Point | 507.5ºC at 760mmHg | |
| Molecular Formula | C14H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.7ºC | |
| Name | N-dibenzothiophen-3-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 507.5ºC at 760mmHg |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.30800 |
| Flash Point | 260.7ºC |
| Exact Mass | 241.05600 |
| PSA | 60.83000 |
| LogP | 4.66240 |
| Index of Refraction | 1.765 |
| InChIKey | KPOVNLZGDMDGIK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)sc1ccccc12 |
| HS Code | 2934999090 |
|---|
|
~%
3-Acetylaminodi... CAS#:64057-52-9 |
| Literature: Gilman; Nobis Journal of the American Chemical Society, 1945 , vol. 67, p. 1479 |
|
~%
3-Acetylaminodi... CAS#:64057-52-9 |
| Literature: Gilman; Nobis Journal of the American Chemical Society, 1945 , vol. 67, p. 1479 |
![4-Iododibenzo[b,d]thiophene structure](https://image.chemsrc.com/caspic/272/132034-89-0.png)
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acetamide,N-3-dibenzothienyl |
| 3-Acetylaminodibenzothiophene |
| N-3-Dibenzothienylacetamide |
| 3-Acetamidodibenzthiophene |
| 3-Acetaminodibenzothiophene |
| N-dibenzothiophen-3-yl-acetamide |