3-Amino-4-(2-hydroxyethoxy)phenylarsonic acid structure
|
Common Name | 3-Amino-4-(2-hydroxyethoxy)phenylarsonic acid | ||
|---|---|---|---|---|
| CAS Number | 64058-65-7 | Molecular Weight | 542.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H34N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2E)-2-[(2E,4E)-6-[acetyl(phenyl)azaniumylidene]hexa-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H34N2O4S |
|---|---|
| Molecular Weight | 542.68800 |
| Exact Mass | 542.22400 |
| PSA | 106.62000 |
| LogP | 6.82470 |
| InChIKey | NDPWNLBKGLNLRA-UHFFFAOYSA-N |
| SMILES | Nc1cc([As](=O)(O)O)ccc1OCCO |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-(2-{(6e)-6-[acetyl(phenyl)iminio]hexa-2,4-dien-1-ylidene}-1,1-dimethyl-1,2-dihydro-3h-benzo[e]indol-3-yl)butane-1-sulfonate |