1-Isopropoxy-3-(o-tolyloxy)-2-propanol carbamate
Modify Date: 2025-09-26 18:49:43
1-Isopropoxy-3-(o-tolyloxy)-2-propanol carbamate structure
|
Common Name | 1-Isopropoxy-3-(o-tolyloxy)-2-propanol carbamate | ||
|---|---|---|---|---|
| CAS Number | 64059-09-2 | Molecular Weight | 267.32100 | |
| Density | 1.099g/cm3 | Boiling Point | 428.4ºC at 760 mmHg | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5ºC | |
| Name | [1-(2-methylphenoxy)-3-propan-2-yloxypropan-2-yl] carbamate |
|---|
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 428.4ºC at 760 mmHg |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32100 |
| Flash Point | 185.5ºC |
| Exact Mass | 267.14700 |
| PSA | 71.77000 |
| LogP | 2.77650 |
| Index of Refraction | 1.508 |
| InChIKey | DZJTUNPUCLMFDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OCC(COC(C)C)OC(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
1-Isopropoxy-3-... CAS#:64059-09-2 |
| Literature: Ludwig; Piech Journal of the American Chemical Society, 1951 , vol. 73, p. 5894 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |