Imidazo[1,2-b]pyridazine-2-aceticacid, 6-chloro structure
|
Common Name | Imidazo[1,2-b]pyridazine-2-aceticacid, 6-chloro | ||
|---|---|---|---|---|
| CAS Number | 64068-07-1 | Molecular Weight | 211.60500 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.60500 |
| Exact Mass | 211.01500 |
| PSA | 67.49000 |
| LogP | 1.00980 |
| Index of Refraction | 1.719 |
| InChIKey | YMOMJMMXKDFINU-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cn2nc(Cl)ccc2n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~53%
Imidazo[1,2-b]p... CAS#:64068-07-1 |
| Literature: Luraschi; Arena; Sacchi; Laneri; Abignente; D'Amico; Berrino; Rossi Farmaco, 1995 , vol. 50, # 5 p. 349 - 354 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 64068-07-1? |
| A: Chinese name of 64068-07-1 is 64068-07-1. |
| Q: What is the CAS number of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: CAS number of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is 64068-07-1. |
| Q: What is the molecular weight of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: Molecular weight of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is 211.60500. |
| Q: What are the upstream materials of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: Related upstream materials(CAS) of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid: 64067-98-7. |
| Q: What is the InChIKey of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: InChIKey of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is YMOMJMMXKDFINU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: SMILES notation of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is O=C(O)Cc1cn2nc(Cl)ccc2n1. |
| Q: What is the polar surface area (PSA) of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: Polar surface area (PSA) of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is 67.49000. |
| Q: What is the English name of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: The English name of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid. |
| Q: What is the molecular formula of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: Molecular formula of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is C8H6ClN3O2. |
| Q: What is the LogP of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid? |
| A: LogP of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)acetic acid is 1.00980. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |