1-[(4-hydroxyphenyl)methyl]-6-methoxyisoquinolin-7-ol
Modify Date: 2025-08-25 11:17:35
![1-[(4-hydroxyphenyl)methyl]-6-methoxyisoquinolin-7-ol Structure](https://image.chemsrc.com/caspic/365/64069-53-0.png)
1-[(4-hydroxyphenyl)methyl]-6-methoxyisoquinolin-7-ol structure
|
Common Name | 1-[(4-hydroxyphenyl)methyl]-6-methoxyisoquinolin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 64069-53-0 | Molecular Weight | 281.30600 | |
| Density | 1.296g/cm3 | Boiling Point | 510ºC at 760 mmHg | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | 1-[(4-hydroxyphenyl)methyl]-6-methoxyisoquinolin-7-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 510ºC at 760 mmHg |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30600 |
| Flash Point | 262.2ºC |
| Exact Mass | 281.10500 |
| PSA | 62.58000 |
| LogP | 3.24540 |
| Index of Refraction | 1.679 |
| InChIKey | XUCRLUHFLBPVRO-UHFFFAOYSA-N |
| SMILES | COc1cc2ccnc(Cc3ccc(O)cc3)c2cc1O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Juzirine |