1,5-dimethoxy-4,8-dinitroanthraquinone structure
|
Common Name | 1,5-dimethoxy-4,8-dinitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 6407-56-3 | Molecular Weight | 358.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dimethoxy-4,8-dinitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10N2O8 |
|---|---|
| Molecular Weight | 358.25900 |
| Exact Mass | 358.04400 |
| PSA | 144.24000 |
| LogP | 3.34200 |
| InChIKey | UKYHPHKDJDQTAH-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c2c1C(=O)c1c([N+](=O)[O-])ccc(OC)c1C2=O |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,5-dimethoxy-4,8-dinitro-anthraquinone |
| 1,5-dinitro-4,8-dimethoxyanthraquinone |
| 1,5-Dimethoxy-4,8-dinitro-anthrachinon |