2-hydroxy-1,3-dinitroanthraquinone structure
|
Common Name | 2-hydroxy-1,3-dinitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 6407-61-0 | Molecular Weight | 314.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-1,3-dinitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6N2O7 |
|---|---|
| Molecular Weight | 314.20700 |
| Exact Mass | 314.01800 |
| PSA | 146.01000 |
| LogP | 3.03040 |
| InChIKey | TZLKPLPTWDBAJS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc([N+](=O)[O-])c(O)c2[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
|
~%
2-hydroxy-1,3-d... CAS#:6407-61-0 |
| Literature: Simon Chemische Berichte, 1881 , vol. 14, p. 464 |
|
~%
2-hydroxy-1,3-d... CAS#:6407-61-0 |
| Literature: Simon Chemische Berichte, 1881 , vol. 14, p. 464 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-hydroxy-1,3-dinitro-anthraquinone |
| 9,10-Anthracenedione,2-hydroxy-1,3-dinitro |
| 2-Hydroxy-1,3-dinitro-anthrachinon |