4-[(2,4-Dimethylphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one structure
|
Common Name | 4-[(2,4-Dimethylphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 6407-78-9 | Molecular Weight | 306.36200 | |
| Density | 1.19 | Boiling Point | 497.8ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | 4-[(2,4-Dimethylphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 |
|---|---|
| Boiling Point | 497.8ºC at 760 mmHg |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.36200 |
| Flash Point | 254.8ºC |
| Exact Mass | 306.14800 |
| PSA | 57.39000 |
| LogP | 3.67900 |
| Index of Refraction | 1.63 |
| InChIKey | KLQVCADYSBUVAV-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1N=Nc1ccc(C)cc1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenyl-4-(2,4-dimethylphenylazo)-5-methyl-2H-pyrazole-3(4H)-one |
| solvent yellow 18 |
| C.I.Food Yellow 12 |
| 4-(2',4'-Dimethylphenylazo)-3-methyl-1-phenylpyrazolin-5-on |
| Sudangelb G |
| 5-methyl-2-phenyl-2H-pyrazole-3,4-dione 4-[(2,4-dimethyl-phenyl)-hydrazone] |