Pytamine hydrochloride
Modify Date: 2026-07-19 09:37:35
Pytamine hydrochloride structure
|
Common Name | Pytamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 641-35-0 | Molecular Weight | 348.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pytamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H29ClN2O |
|---|---|
| Molecular Weight | 348.9 |
| InChIKey | RAJMUIGOGAKFFZ-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1C(OCCN(C)C)c1ccccn1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Pytamine hydrochloride? |
| A: InChIKey of Pytamine hydrochloride is RAJMUIGOGAKFFZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Pytamine hydrochloride? |
| A: SMILES notation of Pytamine hydrochloride is CCc1cccc(CC)c1C(OCCN(C)C)c1ccccn1.Cl. |
| Q: What is the molecular formula of Pytamine hydrochloride? |
| A: Molecular formula of Pytamine hydrochloride is C20H29ClN2O. |
| Q: What is the molecular weight of Pytamine hydrochloride? |
| A: Molecular weight of Pytamine hydrochloride is 348.9. |
| Q: What is the English name of Pytamine hydrochloride? |
| A: The English name of Pytamine hydrochloride is Pytamine hydrochloride. |
| Q: What is the CAS number of Pytamine hydrochloride? |
| A: CAS number of Pytamine hydrochloride is 641-35-0. |
| Q: What is the Chinese name of 641-35-0? |
| A: Chinese name of 641-35-0 is 641-35-0. |