6-Hydroxy-4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-pentylbenzoic acid
![6-Hydroxy-4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-pentylbenzoic acid Structure](https://image.chemsrc.com/caspic/060/641-68-9.png)
6-Hydroxy-4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-pentylbenzoic acid structure
|
Common Name | 6-Hydroxy-4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-pentylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 641-68-9 | Molecular Weight | 430.49100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | anziaic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H30O7 |
|---|---|
| Molecular Weight | 430.49100 |
| Exact Mass | 430.19900 |
| PSA | 124.29000 |
| LogP | 5.18620 |
| InChIKey | BEFYPHLCGVCBFF-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc(OC(=O)c2c(O)cc(O)cc2CCCCC)cc(O)c1C(=O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(2,4-Dihydroxy-6-pentyl-benzoyloxy)-2-hydroxy-6-pentyl-benzoesaeure |
| 4-(2,4-dihydroxy-6-pentyl-benzoyloxy)-2-hydroxy-6-pentyl-benzoic acid |
| Anziasaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of anziaic acid? |
| A: The English name of anziaic acid is anziaic acid. |
| Q: What is the CAS number of anziaic acid? |
| A: CAS number of anziaic acid is 641-68-9. |
| Q: What is the SMILES notation of anziaic acid? |
| A: SMILES notation of anziaic acid is CCCCCc1cc(OC(=O)c2c(O)cc(O)cc2CCCCC)cc(O)c1C(=O)O. |
| Q: What English synonyms does anziaic acid have? |
| A: English synonyms of anziaic acid: 4-(2,4-Dihydroxy-6-pentyl-benzoyloxy)-2-hydroxy-6-pentyl-benzoesaeure, 4-(2,4-dihydroxy-6-pentyl-benzoyloxy)-2-hydroxy-6-pentyl-benzoic acid, Anziasaeure. |
| Q: What is the LogP of anziaic acid? |
| A: LogP of anziaic acid is 5.18620. |
| Q: What is the Chinese name of 641-68-9? |
| A: Chinese name of 641-68-9 is 641-68-9. |
| Q: What is the molecular weight of anziaic acid? |
| A: Molecular weight of anziaic acid is 430.49100. |
| Q: What is the InChIKey of anziaic acid? |
| A: InChIKey of anziaic acid is BEFYPHLCGVCBFF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of anziaic acid? |
| A: Molecular formula of anziaic acid is C24H30O7. |
| Q: What is the polar surface area (PSA) of anziaic acid? |
| A: Polar surface area (PSA) of anziaic acid is 124.29000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |