1-[(2-methoxy-3-methylphenyl)azo]-2-naphthol structure
|
Common Name | 1-[(2-methoxy-3-methylphenyl)azo]-2-naphthol | ||
|---|---|---|---|---|
| CAS Number | 6410-20-4 | Molecular Weight | 292.33200 | |
| Density | 1.17 g/cm3 | Boiling Point | 454.2ºC at 760 mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 1-[(2-methoxy-3-methylphenyl)azo]-2-naphthol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17 g/cm3 |
|---|---|
| Boiling Point | 454.2ºC at 760 mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33200 |
| Flash Point | 228.5ºC |
| Exact Mass | 292.12100 |
| PSA | 54.18000 |
| LogP | 5.27780 |
| Index of Refraction | 1.607 |
| InChIKey | GWDHYAASZOWIJD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)cc1N=Nc1c(O)ccc2ccccc12 |
| HS Code | 2927000090 |
|---|
|
~%
1-[(2-methoxy-3... CAS#:6410-20-4 |
| Literature: Rowe; Levin Journal of the Society of Dyers and Colourists, 1924 , vol. 40, p. 218,222 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-methoxy-5-methylanilin->2-naphthol |
| 1-<2-Methoxy-5-methyl-phenylazo>-2-hydroxy-naphthalin |