Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans structure
|
Common Name | Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans | ||
|---|---|---|---|---|
| CAS Number | 64111-75-7 | Molecular Weight | 282.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26O4 |
|---|---|
| Molecular Weight | 282.37 |
| InChIKey | ANOXPYCDNXHEEE-ZIAGYGMSSA-N |
| SMILES | CCCCOC(=O)C1CC=CCC1C(=O)OCCCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: InChIKey of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is ANOXPYCDNXHEEE-ZIAGYGMSSA-N. |
| Q: What is the molecular formula of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: Molecular formula of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is C16H26O4. |
| Q: What is the English name of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: The English name of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans. |
| Q: What is the Chinese name of 64111-75-7? |
| A: Chinese name of 64111-75-7 is 64111-75-7. |
| Q: What is the SMILES notation of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: SMILES notation of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is CCCCOC(=O)C1CC=CCC1C(=O)OCCCC. |
| Q: What is the CAS number of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: CAS number of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is 64111-75-7. |
| Q: What is the molecular weight of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans? |
| A: Molecular weight of Dibutyl 4-cyclohexene-1,2-dicarboxylate, trans is 282.37. |