1,3-Dioxolane-2-aceticacid, 2,4,5-trimethyl-, ethyl ester structure
|
Common Name | 1,3-Dioxolane-2-aceticacid, 2,4,5-trimethyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6412-85-7 | Molecular Weight | 202.24800 | |
| Density | 0.994g/cm3 | Boiling Point | 233.3ºC at 760mmHg | |
| Molecular Formula | C10H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.8ºC | |
| Name | (R)-2,2,4-trimethyl-1,3-dioxolan-4-yl methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 233.3ºC at 760mmHg |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.24800 |
| Flash Point | 92.8ºC |
| Exact Mass | 202.12100 |
| PSA | 44.76000 |
| LogP | 1.47960 |
| Index of Refraction | 1.42 |
| InChIKey | NTXOHVUXTMVENB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(C)OC(C)C(C)O1 |
|
~%
1,3-Dioxolane-2... CAS#:6412-85-7 |
| Literature: Neish Canadian Journal of Research, Section B: Chemical Sciences, 1947 , vol. 25, p. 423,428, 429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (R)-(2,2,4-trimethyl-1,3-dioxolane-4-yl)-methanol |
| ((R)-2,4r,5t-Trimethyl-[1,3]dioxolan-2-yl)-essigsaeure-aethylester |
| (R)-(+)-2,2,4-trimethyl-4-(hydroxymethyl)-1,3-dioxolane |
| (R)-2,2,4-Trimethyl-1,3-dioxolane-4-methanol |
| 1,3-Dioxolane-4-methanol,2,2,4-trimethyl-,(R) |
| ((R)-2,4r,5t-trimethyl-[1,3]dioxolan-2-yl)-acetic acid ethyl ester |