1,3-Dioxane,2-ethyl-2,5-dimethyl-5-nitro- structure
|
Common Name | 1,3-Dioxane,2-ethyl-2,5-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6413-40-7 | Molecular Weight | 189.20900 | |
| Density | 1.12g/cm3 | Boiling Point | 253.5ºC at 760mmHg | |
| Molecular Formula | C8H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.2ºC | |
| Name | 2-ethyl-2,5-dimethyl-5-nitro-1,3-dioxane |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 253.5ºC at 760mmHg |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.20900 |
| Flash Point | 103.2ºC |
| Exact Mass | 189.10000 |
| PSA | 64.28000 |
| LogP | 1.71800 |
| Index of Refraction | 1.466 |
| InChIKey | RVMYQMJPGAPWCU-UHFFFAOYSA-N |
| SMILES | CCC1(C)OCC(C)([N+](=O)[O-])CO1 |
|
~%
1,3-Dioxane,2-e... CAS#:6413-40-7 |
| Literature: Newman; Magerlein; Wheatley Journal of the American Chemical Society, 1946 , vol. 68, p. 2112,2114 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |