methyl 4-(4-methylbenzoyl)benzoate structure
|
Common Name | methyl 4-(4-methylbenzoyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 64141-11-3 | Molecular Weight | 254.28100 | |
| Density | 1.146g/cm3 | Boiling Point | 404.6ºC at 760mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
| Name | methyl 4-(4-methylbenzoyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 179.7ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.01260 |
| Index of Refraction | 1.569 |
| InChIKey | VOWAVMDPONAQPR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-p-Toluoyl-benzoesaeure-methylester |
| 4-p-toluoyl-benzoic acid methyl ester |
| methyl 4'-methylbenzophenone-4-carboxylate |