(2E)-3-(5-BROMO(2-THIENYL))PROP-2-ENOICACID structure
|
Common Name | (2E)-3-(5-BROMO(2-THIENYL))PROP-2-ENOICACID | ||
|---|---|---|---|---|
| CAS Number | 64154-13-8 | Molecular Weight | 271.29100 | |
| Density | 1.428g/cm3 | Boiling Point | 491.2ºC at 760 mmHg | |
| Molecular Formula | C14H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9ºC | |
| Name | (2e)-3-[5-(1,3-benzothiazol-2-yl)-2-furyl]acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 491.2ºC at 760 mmHg |
| Molecular Formula | C14H9NO3S |
| Molecular Weight | 271.29100 |
| Flash Point | 250.9ºC |
| Exact Mass | 271.03000 |
| PSA | 91.57000 |
| LogP | 3.65410 |
| Index of Refraction | 1.718 |
| InChIKey | UZOULHXGHWZJSM-SOFGYWHQSA-N |
| SMILES | O=C(O)C=Cc1ccc(-c2nc3ccccc3s2)o1 |
| HS Code | 2934999090 |
|---|
|
~%
(2E)-3-(5-BROMO... CAS#:64154-13-8 |
| Literature: Kovac,J. et al. Collection of Czechoslovak Chemical Communications, 1977 , vol. 42, p. 1871 - 1879 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Sulfolanyl-butylsulfid |