(3-ethenyl-2-methylcyclopenten-1-yl)oxy-trimethylsilane structure
|
Common Name | (3-ethenyl-2-methylcyclopenten-1-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 64166-04-7 | Molecular Weight | 196.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-ethenyl-2-methylcyclopenten-1-yl)oxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20OSi |
|---|---|
| Molecular Weight | 196.36100 |
| Exact Mass | 196.12800 |
| PSA | 9.23000 |
| LogP | 3.70790 |
| InChIKey | RRNANBCOHZWQMM-UHFFFAOYSA-N |
| SMILES | C=CC1CCC(O[Si](C)(C)C)=C1C |
|
~%
(3-ethenyl-2-me... CAS#:64166-04-7 |
| Literature: Funk; Vollhardt Journal of the American Chemical Society, 1980 , vol. 102, # 16 p. 5253 - 5261 |
|
~%
(3-ethenyl-2-me... CAS#:64166-04-7 |
| Literature: Funk; Vollhardt Journal of the American Chemical Society, 1977 , vol. 99, # 16 p. 5483 - 5484 |
| 2-Methyl-1-trimethylsiloxy-3-vinylcyclopent-1-ene |
| 3-vinyl-2-methyl-1-trimethylsilyloxy-1-cyclopentene |
| 2-Methyl-1-trimethylsilyloxy-3-vinyl-1-cyclopenten |