4-nitro-N-phenylsulfanylaniline structure
|
Common Name | 4-nitro-N-phenylsulfanylaniline | ||
|---|---|---|---|---|
| CAS Number | 64168-52-1 | Molecular Weight | 246.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-N-phenylsulfanylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10N2O2S |
|---|---|
| Molecular Weight | 246.28500 |
| Exact Mass | 246.04600 |
| PSA | 83.15000 |
| LogP | 4.31020 |
| InChIKey | ZWORRJVNOUBPPJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NSc2ccccc2)cc1 |
|
~%
4-nitro-N-pheny... CAS#:64168-52-1 |
| Literature: Claus, Peter K.; Silbernagel, Waltraud; Franek, Walter; Rieder, Werner Monatshefte fuer Chemie, 1985 , vol. 116, p. 841 - 850 |
|
~%
4-nitro-N-pheny... CAS#:64168-52-1 |
| Literature: Miura,Y.; Kinoshita,M. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 1142 - 1146 |
| p-nitrobenzenesulphenanilide |
| 4'-nitrobenzenesulphenanilide |
| 4'-nitrobenzenesulfenanilide |
| 4'-nitrobenzenesulfenylanilide |