bis(2-hydroxyethyl)ammonium 2,4,5-trichlorophenoxyacetate structure
|
Common Name | bis(2-hydroxyethyl)ammonium 2,4,5-trichlorophenoxyacetate | ||
|---|---|---|---|---|
| CAS Number | 6417-43-2 | Molecular Weight | 360.618 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16Cl3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,5-Trichlorophenoxy)acetic acid-2,2'-iminodiethanol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16Cl3NO5 |
|---|---|
| Molecular Weight | 360.618 |
| Exact Mass | 359.009399 |
| InChIKey | QKBDWMJBSCEOOL-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc(Cl)c(Cl)cc1Cl.OCCNCCO |
| Acetic acid, 2-(2,4,5-trichlorophenoxy)-, compd. with 2,2'-iminobis[ethanol] (1:1) |
| EINECS 229-138-1 |
| 2-Hydroxy-N-(2-hydroxyethyl)ethanaminium (2,4,5-trichlorophenoxy)acetate |
| Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with 2,2′-iminobis[ethanol] (1:1) |
| (2,4,5-Trichlorophenoxy)acetic acid - 2,2'-iminodiethanol (1:1) |