Alloimperatorin structure
|
Common Name | Alloimperatorin | ||
|---|---|---|---|---|
| CAS Number | 642-05-7 | Molecular Weight | 270.28000 | |
| Density | 1.298g/cm3 | Boiling Point | 476.1ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | 224-225ºC | |
| MSDS | N/A | Flash Point | 241.8ºC | |
Use of AlloimperatorinAlloimperatorin (Prangenidin), a coumarin compound, is extracted from Angelica dahurica. Alloimperatorin (Prangenidin) has antitumor activity[1][2]. |
| Name | 9-hydroxy-4-(3-methylbut-2-enyl)furo[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Alloimperatorin (Prangenidin), a coumarin compound, is extracted from Angelica dahurica. Alloimperatorin (Prangenidin) has antitumor activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 476.1ºC at 760 mmHg |
| Melting Point | 224-225ºC |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 241.8ºC |
| Exact Mass | 270.08900 |
| PSA | 63.58000 |
| LogP | 3.75350 |
| Index of Refraction | 1.641 |
| InChIKey | KDXVVZMYSLWJMA-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c2ccoc2c(O)c2oc(=O)ccc12 |
| Storage condition | 2-8℃ |
| HS Code | 2932999099 |
|---|
|
~%
Alloimperatorin CAS#:642-05-7 |
| Literature: Abou-Elzahab; Metwally; Dawidar; Abdel-Mogib; Abu-Mustafa Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 12 p. 4433 - 4435 |
|
~%
Alloimperatorin CAS#:642-05-7 |
| Literature: Loutfy Pharmazie, 1981 , vol. 36, # 2 p. 166 - 166 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Prangenidin |
| Alloimperatorin |
| 8-Hydroxy-5-isopentyl-6,7:4',5'-furocumarin |