4-[(R)-2-[(1R,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione
![4-[(R)-2-[(1R,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione Structure](https://image.chemsrc.com/caspic/066/642-81-9.png)
4-[(R)-2-[(1R,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione structure
|
Common Name | 4-[(R)-2-[(1R,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione | ||
|---|---|---|---|---|
| CAS Number | 642-81-9 | Molecular Weight | 281.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Cycloheximide, also known as 4-[(R)-2-[(1R,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]-2,6-piperidinedione, has a CAS number of 642-81-9 and a molecular formula of C15H23NO4. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cycloheximide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO4 |
|---|---|
| Molecular Weight | 281.34700 |
| Exact Mass | 281.16300 |
| PSA | 83.47000 |
| LogP | 1.37030 |
| InChIKey | YPHMISFOHDHNIV-GAIPPQHRSA-N |
| SMILES | CC1CC(C)C(=O)C(C(O)CC2CC(=O)NC(=O)C2)C1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Cycloheximid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Cycloheximide? |
| A: CAS number of Cycloheximide is 642-81-9. |
| Q: What is the English name of Cycloheximide? |
| A: The English name of Cycloheximide is Cycloheximide. |
| Q: What English synonyms does Cycloheximide have? |
| A: English synonyms of Cycloheximide: Cycloheximid. |
| Q: What is the LogP of Cycloheximide? |
| A: LogP of Cycloheximide is 1.37030. |
| Q: What is the polar surface area (PSA) of Cycloheximide? |
| A: Polar surface area (PSA) of Cycloheximide is 83.47000. |
| Q: What is the SMILES notation of Cycloheximide? |
| A: SMILES notation of Cycloheximide is CC1CC(C)C(=O)C(C(O)CC2CC(=O)NC(=O)C2)C1. |
| Q: What is the Chinese name of 642-81-9? |
| A: Chinese name of 642-81-9 is 642-81-9. |
| Q: What is the molecular weight of Cycloheximide? |
| A: Molecular weight of Cycloheximide is 281.34700. |
| Q: What is the molecular formula of Cycloheximide? |
| A: Molecular formula of Cycloheximide is C15H23NO4. |
| Q: What is the InChIKey of Cycloheximide? |
| A: InChIKey of Cycloheximide is YPHMISFOHDHNIV-GAIPPQHRSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |