Phenol,4,4'-(1-methylpropylidene)bis[2-methyl- structure
|
Common Name | Phenol,4,4'-(1-methylpropylidene)bis[2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6420-65-1 | Molecular Weight | 270.36600 | |
| Density | 1.087g/cm3 | Boiling Point | 422ºC at 760 mmHg | |
| Molecular Formula | C18H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 4-[2-(4-hydroxy-3-methylphenyl)butan-2-yl]-2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 422ºC at 760 mmHg |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.36600 |
| Flash Point | 194.3ºC |
| Exact Mass | 270.16200 |
| PSA | 40.46000 |
| LogP | 4.43060 |
| Index of Refraction | 1.577 |
| InChIKey | KKBHVPNWMXTNBL-UHFFFAOYSA-N |
| SMILES | CCC(C)(c1ccc(O)c(C)c1)c1ccc(O)c(C)c1 |
| HS Code | 2907299090 |
|---|
|
~%
Phenol,4,4'-(1-... CAS#:6420-65-1 |
| Literature: Easson et al. Quarterly Journal of Pharmacy and Pharmacology, 1934 , vol. 7, p. 509,510, 511 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2'-Dimethyl-4,4'-sec-butyliden-di-phenol |
| EINECS 229-168-5 |
| 4.4'-sek.-Butyliden-di-o-kresol |
| 2,2'-dimethyl-4,4'-sec-butylidene-di-phenol |