17-Aminodemethoxygeldanamycin structure
|
Common Name | 17-Aminodemethoxygeldanamycin | ||
|---|---|---|---|---|
| CAS Number | 64202-81-9 | Molecular Weight | 547.61100 | |
| Density | 1.25g/cm3 | Boiling Point | 777.8ºC at 760 mmHg | |
| Molecular Formula | C28H39N3O8 | Melting Point | 178-180ºC | |
| MSDS | N/A | Flash Point | 424.2ºC | |
| Name | 17-Amino Geldanamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 777.8ºC at 760 mmHg |
| Melting Point | 178-180ºC |
| Molecular Formula | C28H39N3O8 |
| Molecular Weight | 547.61100 |
| Flash Point | 424.2ºC |
| Exact Mass | 547.27400 |
| PSA | 180.27000 |
| LogP | 3.45010 |
| Index of Refraction | 1.574 |
| InChIKey | XYFFWTYOFPSZRM-XAOKHGAUSA-N |
| SMILES | COC1C=CC=C(C)C(=O)NC2=CC(=O)C(N)=C(CC(C)CC(OC)C(O)C(C)C=C(C)C1OC(N)=O)C2=O |
|
~96%
17-Aminodemetho... CAS#:64202-81-9 |
| Literature: VAN ANDEL RESEARCH INSTITUTE Patent: WO2005/95347 A1, 2005 ; Location in patent: Page/Page column 34; 35 ; |
|
~%
17-Aminodemetho... CAS#:64202-81-9 |
| Literature: Zheng, Nan; Zou, Peng; Wang, Shaomeng; Sun, Duxin Drug Metabolism and Disposition, 2011 , vol. 39, # 4 p. 627 - 635 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 17-Aminodemethoxygeldanamycin |