tributoxy(chloro)silane
tributoxy(chloro)silane structure
|
Common Name | tributoxy(chloro)silane | ||
|---|---|---|---|---|
| CAS Number | 6421-39-2 | Molecular Weight | 282.87900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27ClO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tributoxy(chloro)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H27ClO3Si |
|---|---|
| Molecular Weight | 282.87900 |
| Exact Mass | 282.14200 |
| PSA | 27.69000 |
| LogP | 4.11090 |
| InChIKey | RYFIHIMBHQWVNQ-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](Cl)(OCCCC)OCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tributoxychlorosilane |
| Chlor-tri-n-butoxy-silan |
| Chlor-tributyloxy-silan |
| tri-n-butyloxychlorosilane |
| Silane,tributoxychloro |
| Tributoxy-chlor-silan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of tributoxy(chloro)silane? |
| A: Polar surface area (PSA) of tributoxy(chloro)silane is 27.69000. |
| Q: What is the InChIKey of tributoxy(chloro)silane? |
| A: InChIKey of tributoxy(chloro)silane is RYFIHIMBHQWVNQ-UHFFFAOYSA-N. |
| Q: What is the English name of tributoxy(chloro)silane? |
| A: The English name of tributoxy(chloro)silane is tributoxy(chloro)silane. |
| Q: What is the CAS number of tributoxy(chloro)silane? |
| A: CAS number of tributoxy(chloro)silane is 6421-39-2. |
| Q: What is the SMILES notation of tributoxy(chloro)silane? |
| A: SMILES notation of tributoxy(chloro)silane is CCCCO[Si](Cl)(OCCCC)OCCCC. |
| Q: What English synonyms does tributoxy(chloro)silane have? |
| A: English synonyms of tributoxy(chloro)silane: tributoxychlorosilane, Chlor-tri-n-butoxy-silan, Chlor-tributyloxy-silan, tri-n-butyloxychlorosilane, Silane,tributoxychloro, Tributoxy-chlor-silan. |
| Q: What is the molecular weight of tributoxy(chloro)silane? |
| A: Molecular weight of tributoxy(chloro)silane is 282.87900. |
| Q: What is the molecular formula of tributoxy(chloro)silane? |
| A: Molecular formula of tributoxy(chloro)silane is C12H27ClO3Si. |
| Q: What is the Chinese name of 6421-39-2? |
| A: Chinese name of 6421-39-2 is 6421-39-2. |
| Q: What is the LogP of tributoxy(chloro)silane? |
| A: LogP of tributoxy(chloro)silane is 4.11090. |