5-(5-chloropyridin-2-yl)-N,N-diethyl-4-phenyl-1,3-thiazol-2-amine structure
|
Common Name | 5-(5-chloropyridin-2-yl)-N,N-diethyl-4-phenyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 64228-06-4 | Molecular Weight | 343.87400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(5-chloropyridin-2-yl)-N,N-diethyl-4-phenyl-1,3-thiazol-2-amine |
|---|
| Molecular Formula | C18H18ClN3S |
|---|---|
| Molecular Weight | 343.87400 |
| Exact Mass | 343.09100 |
| PSA | 57.26000 |
| LogP | 5.37170 |
| InChIKey | DAGMJRJZQXZDAV-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(-c2ccccc2)c(-c2ccc(Cl)cn2)s1 |
|
~%
5-(5-chloropyri... CAS#:64228-06-4 |
| Literature: Le Count,D.J.; Jarvis,J.A.J. Journal of the Chemical Society, Chemical Communications, 1977 , p. 282 - 283 |