2,4(1H,3H)-Pteridinedione,6-(4-chlorophenyl)- structure
|
Common Name | 2,4(1H,3H)-Pteridinedione,6-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 64233-23-4 | Molecular Weight | 274.66300 | |
| Density | 1.484g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-chlorophenyl)-1H-pteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.484g/cm3 |
|---|---|
| Molecular Formula | C12H7ClN4O2 |
| Molecular Weight | 274.66300 |
| Exact Mass | 274.02600 |
| PSA | 91.50000 |
| LogP | 1.32680 |
| Index of Refraction | 1.637 |
| InChIKey | QVWBTEKCOOHUOG-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2nc(-c3ccc(Cl)cc3)cnc2[nH]1 |
|
~70%
2,4(1H,3H)-Pter... CAS#:64233-23-4 |
| Literature: Singh; Geetanjali Russian Journal of Organic Chemistry, 2006 , vol. 42, # 1 p. 136 - 138 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms2635a16 |