2H-Benzimidazol-2-one, 1,3-dihydro-4-hydroxy-6-nitro- structure
|
Common Name | 2H-Benzimidazol-2-one, 1,3-dihydro-4-hydroxy-6-nitro- | ||
|---|---|---|---|---|
| CAS Number | 64236-24-4 | Molecular Weight | 195.13200 | |
| Density | 1.662g/cm3 | Boiling Point | 233.7ºC at 760 mmHg | |
| Molecular Formula | C7H5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.2ºC | |
| Name | 4-hydroxy-6-nitro-1,3-dihydrobenzimidazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Boiling Point | 233.7ºC at 760 mmHg |
| Molecular Formula | C7H5N3O4 |
| Molecular Weight | 195.13200 |
| Flash Point | 95.2ºC |
| Exact Mass | 195.02800 |
| PSA | 114.96000 |
| LogP | 1.40550 |
| Index of Refraction | 1.682 |
| InChIKey | VZKJYVHVMQZCOZ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc(O)c2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
2H-Benzimidazol... CAS#:64236-24-4 |
| Literature: Gillespie et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 2445 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dihydro-4-hydroxy-6-nitro-2H-benzimidazol-2-one |
| 4-hydroxy-6-nitro-1,3-dihydro-benzimidazol-2-one |
| 2H-Benzimidazol-2-one,1,3-dihydro-4-hydroxy-6-nitro |