1,3,5-tribromo-2-(4-bromophenyl)benzene structure
|
Common Name | 1,3,5-tribromo-2-(4-bromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 64258-02-2 | Molecular Weight | 469.79200 | |
| Density | 2.14g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C12H6Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
| Name | 1,3,5-tribromo-2-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.79200 |
| Flash Point | 195.3ºC |
| Exact Mass | 465.72000 |
| LogP | 6.40360 |
| Index of Refraction | 1.666 |
| InChIKey | QOYZOHLNXSXCTO-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2c(Br)cc(Br)cc2Br)cc1 |
| HS Code | 2903999090 |
|---|
|
~%
1,3,5-tribromo-... CAS#:64258-02-2 |
| Literature: Field,L.D. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 5249 - 5253 |
|
~%
1,3,5-tribromo-... CAS#:64258-02-2 |
| Literature: Case Journal of the American Chemical Society, 1939 , vol. 61, p. 3487,3489 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4,4',6-Tetrabromo-1,1'-biphenyl |
| PBB 75 |
| 2,4,6,4'-tetrabromo-biphenyl |
| 2,4,4',6-Tetrabromobiphenyl |
| 1,1'-Biphenyl,2,4,4',6-tetrabromo |
| 2,4,4',6-Tetrabrombiphenyl |
| 2,4,6,4'-Tetrabrom-biphenyl |