2,4'',6-Tribromobiphenyl structure
|
Common Name | 2,4'',6-Tribromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 64258-03-3 | Molecular Weight | 390.89600 | |
| Density | 1.923g/cm3 | Boiling Point | 374.4ºC at 760 mmHg | |
| Molecular Formula | C12H7Br3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 1,3-dibromo-2-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.923g/cm3 |
|---|---|
| Boiling Point | 374.4ºC at 760 mmHg |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.89600 |
| Flash Point | 175.2ºC |
| Exact Mass | 387.81000 |
| LogP | 5.64110 |
| Index of Refraction | 1.647 |
| InChIKey | BCWVIZFLJCJGPL-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2c(Br)cccc2Br)cc1 |
| HS Code | 2903999090 |
|---|
|
~%
2,4'',6-Tribrom... CAS#:64258-03-3 |
| Literature: Field,L.D. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 5249 - 5253 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4',6-Tribromo-1,1'-biphenyl |
| 1,1'-Biphenyl,2,4',6-tribromo |
| 2,4',6-Tribrombiphenyl |
| 2,4',6-TRIBROMOBIPHENYL |
| PBB 32 |