2-(4-bromophenyl)-1,3,5-trichlorobenzene structure
|
Common Name | 2-(4-bromophenyl)-1,3,5-trichlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 64258-05-5 | Molecular Weight | 336.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6BrCl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-bromophenyl)-1,3,5-trichlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H6BrCl3 |
|---|---|
| Molecular Weight | 336.43900 |
| Exact Mass | 333.87200 |
| LogP | 6.07630 |
| InChIKey | XFBDPFMKACDEFC-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(-c2ccc(Br)cc2)c(Cl)c1 |
|
~%
2-(4-bromopheny... CAS#:64258-05-5 |
| Literature: Field,L.D. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 5249 - 5253 |
| 4'-bromo-2,4,6-trichlorobiphenyl |
| 4-Brom-2',4',6'-trichlorobiphenyl |
| 1,1'-Biphenyl,4'-bromo-2,4,6-trichloro |