3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid
3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid structure
|
Common Name | 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 64286-79-9 | Molecular Weight | 198.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid (Chinese name: 3,5-二甲氧基-1-甲基环己二烯-1-甲酸, CAS number: 64286-79-9, molecular formula: C10H14O4, molecular weight: 198.21600), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14O4 |
|---|---|
| Molecular Weight | 198.21600 |
| Exact Mass | 198.08900 |
| PSA | 55.76000 |
| LogP | 1.54160 |
| InChIKey | BNZOIACRCVTFKZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(C)(C(=O)O)C=C(OC)C1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:4179-19-5
CAS#:73702-87-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-dimethoxy-1-methyl-2,5-cyclohexadiene-1-carboxylic acid |
| 1-methyl-3,5-dimethoxy-1,4-dihydrobenzoic acid |
| 3,5-dimethoxy-1-methylcyclohexa-2,5-dien-1-carboxylic acid |
| 3-carboxy-3-methyl-1,5-dimethoxy-1,4-cyclohexadiene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid have? |
| A: English synonyms of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid: 3,5-dimethoxy-1-methyl-2,5-cyclohexadiene-1-carboxylic acid, 1-methyl-3,5-dimethoxy-1,4-dihydrobenzoic acid, 3,5-dimethoxy-1-methylcyclohexa-2,5-dien-1-carboxylic acid, 3-carboxy-3-methyl-1,5-dimethoxy-1,4-cyclohexadiene. |
| Q: What is the molecular weight of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: Molecular weight of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is 198.21600. |
| Q: What is the Chinese name of 64286-79-9? |
| A: Chinese name of 64286-79-9 is 64286-79-9. |
| Q: What is the English name of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: The English name of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid. |
| Q: What is the InChIKey of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: InChIKey of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is BNZOIACRCVTFKZ-UHFFFAOYSA-N. |
| Q: What are the downstream products of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: Related downstream products(CAS) of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid: 4179-19-5;73702-87-1. |
| Q: What is the LogP of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: LogP of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is 1.54160. |
| Q: What is the SMILES notation of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: SMILES notation of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is COC1=CC(C)(C(=O)O)C=C(OC)C1. |
| Q: What is the CAS number of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: CAS number of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is 64286-79-9. |
| Q: What is the polar surface area (PSA) of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid? |
| A: Polar surface area (PSA) of 3,5-dimethoxy-1-methylcyclohexa-2,5-diene-1-carboxylic acid is 55.76000. |