trimethyl(1-trimethylsilyloxyprop-1-enyl)silane
Modify Date: 2026-07-14 10:42:56
trimethyl(1-trimethylsilyloxyprop-1-enyl)silane structure
|
Common Name | trimethyl(1-trimethylsilyloxyprop-1-enyl)silane | ||
|---|---|---|---|---|
| CAS Number | 64299-50-9 | Molecular Weight | 202.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H22OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(1-trimethylsilyloxyprop-1-enyl)silane |
|---|
| Molecular Formula | C9H22OSi2 |
|---|---|
| Molecular Weight | 202.44100 |
| Exact Mass | 202.12100 |
| PSA | 9.23000 |
| LogP | 3.61910 |
| InChIKey | PXXZSKMOIKLUSR-UHFFFAOYSA-N |
| SMILES | CC=C(O[Si](C)(C)C)[Si](C)(C)C |
|
~75%
trimethyl(1-tri... CAS#:64299-50-9 |
| Literature: Kuwajima, Isao; Mori, Akio; Kato, Masahiro Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 9 p. 2634 - 2638 |
|
~87%
trimethyl(1-tri... CAS#:64299-50-9 |
| Literature: Murai, Shinji; Ryu, Ilhyong; Iriguchi, Jiro; Sonoda, Norobu Journal of the American Chemical Society, 1984 , vol. 106, # 8 p. 2440 - 2442 |
