(1s,2s)-2-(naphthalene-2,3-dicarboximido)cyclohexanecarboxylic acid structure
|
Common Name | (1s,2s)-2-(naphthalene-2,3-dicarboximido)cyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 642995-16-2 | Molecular Weight | 323.343 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 554.6±43.0 °C at 760 mmHg | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.2±28.2 °C | |
| Name | (1S,2S)-2-(1,3-dioxobenzo[f]isoindol-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.6±43.0 °C at 760 mmHg |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.343 |
| Flash Point | 289.2±28.2 °C |
| Exact Mass | 323.115753 |
| PSA | 74.68000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | RPVXICJCKYVHHZ-BBRMVZONSA-N |
| SMILES | O=C(O)C1CCCCC1N1C(=O)c2cc3ccccc3cc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (1S,2S)-2-(1,3-Dioxo-1,3-dihydro-2H-benzo[f]isoindol-2-yl)cyclohexanecarboxylic acid |
| N-[(1S,2S)-2-Carboxycyclohexyl]naphthalene-2,3-dicarboximide |
| (1S,2S)-2-(Naphthalene-2,3-dicarboximido)cyclohexanecarboxylic Acid |
| N0714 |