4,7-Dihydroxy-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-2H-1-benzopyran-2-one
4,7-Dihydroxy-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-2H-1-benzopyran-2-one structure
|
Common Name | 4,7-Dihydroxy-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-2H-1-benzopyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 643-57-2 | Molecular Weight | 382.49300 | |
| Density | 1.121g/cm3 | Boiling Point | 545.7ºC at 760 mmHg | |
| Molecular Formula | C24H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
Summary: 4,7-Dihydroxy-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-2H-1-benzopyran-2-one (Chinese name: 4,7-二羟基-3-[(2E,6E)-3,7,11-三甲基十三烯-2,6,10-三烯基]香豆素, CAS number: 643-57-2, molecular formula: C24H30O4), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 545.7ºC at 760 mmHg |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.49300 |
| Flash Point | 182.3ºC |
| Exact Mass | 382.21400 |
| PSA | 70.67000 |
| LogP | 6.16590 |
| Index of Refraction | 1.573 |
| InChIKey | BRIROITVQMZRGP-XURGJTJWSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)c2ccc(O)cc2oc1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity against squalene hopene cyclase from Alicyclobacillus acidocaldar...
Source: ChEMBL
Target: Squalene--hopene cyclase
External Id: CHEMBL809139
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ammoresinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: SMILES notation of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)c2ccc(O)cc2oc1=O. |
| Q: What is the English name of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: The English name of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one. |
| Q: What is the CAS number of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: CAS number of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 643-57-2. |
| Q: What is the LogP of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: LogP of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 6.16590. |
| Q: What is the boiling point of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: Boiling point of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 545.7ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: Polar surface area (PSA) of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 70.67000. |
| Q: What is the molecular weight of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: Molecular weight of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is 382.49300. |
| Q: What is the Chinese name of 643-57-2? |
| A: Chinese name of 643-57-2 is 643-57-2. |
| Q: What is the molecular formula of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one? |
| A: Molecular formula of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one is C24H30O4. |
| Q: What English synonyms does 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one have? |
| A: English synonyms of 4,7-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one: Ammoresinol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |