2H-Pyran-2-one,4-methoxy-6-(3-pyridinyl)
2H-Pyran-2-one,4-methoxy-6-(3-pyridinyl) structure
|
Common Name | 2H-Pyran-2-one,4-methoxy-6-(3-pyridinyl) | ||
|---|---|---|---|---|
| CAS Number | 643-91-4 | Molecular Weight | 203.19400 | |
| Density | 1.27g/cm3 | Boiling Point | 448.2ºC at 760mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxy-6-pyridin-3-ylpyran-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760mmHg |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 224.8ºC |
| Exact Mass | 203.05800 |
| PSA | 52.33000 |
| LogP | 1.71040 |
| Index of Refraction | 1.585 |
| InChIKey | WOOQLVPKDONBEX-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cccnc2)oc(=O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:121675-37-4
CAS#:186581-53-3
CAS#:80601-69-0
CAS#:350-03-8
CAS#:36740-09-7
CAS#:35471-25-1
CAS#:121675-33-0
CAS#:614-18-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methoxy-6-(pyridin-3-yl)-2h-pyran-2-one |
| 4-Methoxy-6-[3]pyridyl-pyran-2-on |
| 4-methoxy-6-(3'-pyridyl)-2H-pyran-2-one |
| Anibine |
| 4-methoxy-6-[3]pyridyl-pyran-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: InChIKey of 4-methoxy-6-pyridin-3-ylpyran-2-one is WOOQLVPKDONBEX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: Molecular formula of 4-methoxy-6-pyridin-3-ylpyran-2-one is C11H9NO3. |
| Q: What is the Chinese name of 643-91-4? |
| A: Chinese name of 643-91-4 is 643-91-4. |
| Q: What is the CAS number of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: CAS number of 4-methoxy-6-pyridin-3-ylpyran-2-one is 643-91-4. |
| Q: What is the polar surface area (PSA) of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: Polar surface area (PSA) of 4-methoxy-6-pyridin-3-ylpyran-2-one is 52.33000. |
| Q: What is the boiling point of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: Boiling point of 4-methoxy-6-pyridin-3-ylpyran-2-one is 448.2ºC at 760mmHg. |
| Q: What is the molecular weight of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: Molecular weight of 4-methoxy-6-pyridin-3-ylpyran-2-one is 203.19400. |
| Q: What are the upstream materials of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: Related upstream materials(CAS) of 4-methoxy-6-pyridin-3-ylpyran-2-one: 121675-37-4;186581-53-3;80601-69-0;350-03-8;36740-09-7;35471-25-1;121675-33-0;614-18-6. |
| Q: What is the SMILES notation of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: SMILES notation of 4-methoxy-6-pyridin-3-ylpyran-2-one is COc1cc(-c2cccnc2)oc(=O)c1. |
| Q: What is the LogP of 4-methoxy-6-pyridin-3-ylpyran-2-one? |
| A: LogP of 4-methoxy-6-pyridin-3-ylpyran-2-one is 1.71040. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |