2,4-dibromo-1-(4-bromophenyl)benzene structure
|
Common Name | 2,4-dibromo-1-(4-bromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 6430-90-6 | Molecular Weight | 390.89600 | |
| Density | 1.923g/cm3 | Boiling Point | 386.3ºC at 760mmHg | |
| Molecular Formula | C12H7Br3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | 2,4-dibromo-1-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.923g/cm3 |
|---|---|
| Boiling Point | 386.3ºC at 760mmHg |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.89600 |
| Flash Point | 181.9ºC |
| Exact Mass | 387.81000 |
| LogP | 5.64110 |
| Index of Refraction | 1.647 |
| InChIKey | VALVUQTWSYUYTO-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2ccc(Br)cc2Br)cc1 |
|
~%
2,4-dibromo-1-(... CAS#:6430-90-6 |
| Literature: Loh; Turner Journal of the Chemical Society, 1955 , p. 1274,1277 |
|
~%
2,4-dibromo-1-(... CAS#:6430-90-6 |
| Literature: Loh; Turner Journal of the Chemical Society, 1955 , p. 1274,1277 |
| 2,4,4'-Tribromo-1,1'-biphenyl |
| PBB 28 |
| 2,4,4'-Tribrom-biphenyl |
| 1,1'-Biphenyl,2,4,4'-tribromo |
| 2,4,4'-Tribromobiphenyl |