N-(4-azido-2-nitrophenyl)-1,2-diaminoethane structure
|
Common Name | N-(4-azido-2-nitrophenyl)-1,2-diaminoethane | ||
|---|---|---|---|---|
| CAS Number | 64309-07-5 | Molecular Weight | 222.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(4-azido-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10N6O2 |
|---|---|
| Molecular Weight | 222.20400 |
| Exact Mass | 222.08700 |
| PSA | 133.62000 |
| LogP | 2.65646 |
| InChIKey | HDDVMWUNPMNQSE-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(NCCN)c([N+](=O)[O-])c1 |
| HS Code | 2929909090 |
|---|
|
~90%
N-(4-azido-2-ni... CAS#:64309-07-5 |
| Literature: Yoshida; Nakayama; Hatanaka; Kanaoka Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 4 p. 982 - 987 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Nitro-4-azidophenylethylenediamine |
| Baeana |