4-ETHYL-4'-METHOXYBENZOPHENONE
4-ETHYL-4'-METHOXYBENZOPHENONE structure
|
Common Name | 4-ETHYL-4'-METHOXYBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 64357-92-2 | Molecular Weight | 240.29700 | |
| Density | 1.071g/cm3 | Boiling Point | 378.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-ethylphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 378.1ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 165.9ºC |
| Exact Mass | 240.11500 |
| PSA | 26.30000 |
| LogP | 3.48860 |
| Index of Refraction | 1.557 |
| InChIKey | SFHFSYOQXXNZCP-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)c2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
4-ETHYL-4'-METH... CAS#:64357-92-2 |
| Literature: THERACOS, INC. Patent: WO2008/83200 A2, 2008 ; Location in patent: Page/Page column 50-51 ; WO 2008/083200 A2 |
|
~%
4-ETHYL-4'-METH... CAS#:64357-92-2 |
| Literature: BE850024US4124726 , ; Chem.Abstr., , vol. 90, # 168289 DE2659580 , ; Chem.Abstr., , vol. 87, # 167732 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-ethyl-4'-methoxybenzophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: InChIKey of (4-ethylphenyl)-(4-methoxyphenyl)methanone is SFHFSYOQXXNZCP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: Molecular weight of (4-ethylphenyl)-(4-methoxyphenyl)methanone is 240.29700. |
| Q: What is the molecular formula of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: Molecular formula of (4-ethylphenyl)-(4-methoxyphenyl)methanone is C16H16O2. |
| Q: What is the boiling point of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: Boiling point of (4-ethylphenyl)-(4-methoxyphenyl)methanone is 378.1ºC at 760 mmHg. |
| Q: What is the LogP of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: LogP of (4-ethylphenyl)-(4-methoxyphenyl)methanone is 3.48860. |
| Q: What is the CAS number of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: CAS number of (4-ethylphenyl)-(4-methoxyphenyl)methanone is 64357-92-2. |
| Q: What English synonyms does (4-ethylphenyl)-(4-methoxyphenyl)methanone have? |
| A: English synonyms of (4-ethylphenyl)-(4-methoxyphenyl)methanone: 4-ethyl-4'-methoxybenzophenone. |
| Q: What is the polar surface area (PSA) of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: Polar surface area (PSA) of (4-ethylphenyl)-(4-methoxyphenyl)methanone is 26.30000. |
| Q: What is the SMILES notation of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: SMILES notation of (4-ethylphenyl)-(4-methoxyphenyl)methanone is CCc1ccc(C(=O)c2ccc(OC)cc2)cc1. |
| Q: What is the English name of (4-ethylphenyl)-(4-methoxyphenyl)methanone? |
| A: The English name of (4-ethylphenyl)-(4-methoxyphenyl)methanone is (4-ethylphenyl)-(4-methoxyphenyl)methanone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |