4-N-BUTYL-3'-IODOBENZOPHENONE structure
|
Common Name | 4-N-BUTYL-3'-IODOBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 64358-32-3 | Molecular Weight | 364.22100 | |
| Density | 1.425g/cm3 | Boiling Point | 433.9ºC at 760 mmHg | |
| Molecular Formula | C17H17IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | (4-butylphenyl)-(3-iodophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 433.9ºC at 760 mmHg |
| Molecular Formula | C17H17IO |
| Molecular Weight | 364.22100 |
| Flash Point | 216.2ºC |
| Exact Mass | 364.03200 |
| PSA | 17.07000 |
| LogP | 4.86480 |
| Index of Refraction | 1.603 |
| InChIKey | LLTFZPUYDAAGKV-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)c2cccc(I)c2)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
4-N-BUTYL-3'-IO... CAS#:64358-32-3 |
| Literature: BE850024US4124726 , ; Chem.Abstr., , vol. 90, # 168289 DE2659580 , ; Chem.Abstr., , vol. 87, # 167732 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-n-Butyl-3'-iodobenzophenone |