POLY(2 2 3 4 4 4-HEXAFLUOROBUTYL METHAC& structure
|
Common Name | POLY(2 2 3 4 4 4-HEXAFLUOROBUTYL METHAC& | ||
|---|---|---|---|---|
| CAS Number | 64376-86-9 | Molecular Weight | 250.138 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 168.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H8F6O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 56.7±0.0 °C | |
| Name | Poly(2,2,3,4,4,4-hexafluorobutyl methacrylate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 168.6±40.0 °C at 760 mmHg |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.138 |
| Flash Point | 56.7±0.0 °C |
| Exact Mass | 250.042847 |
| LogP | 2.78 |
| Vapour Pressure | 1.6±0.3 mmHg at 25°C |
| Index of Refraction | 1.350 |
| InChIKey | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)C(F)(F)F |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 2-Propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester |
| MFCD00042311 |
| 2,2,3,4,4,4-Hexafluorobutyl 2-methylacrylate |
| MFCD04975234 |
| 2,2,3,4,4,4-Hexafluorobutyl methacrylate |