Guanidine,N-(3-chloropropyl)-N'-nitro-N-nitroso- (9CI)
Modify Date: 2025-08-24 20:09:32
Guanidine,N-(3-chloropropyl)-N'-nitro-N-nitroso- (9CI) structure
|
Common Name | Guanidine,N-(3-chloropropyl)-N'-nitro-N-nitroso- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64398-16-9 | Molecular Weight | 209.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H8ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Nitroso-1-(3-chloropropyl)-3-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H8ClN5O3 |
|---|---|
| Molecular Weight | 209.59100 |
| Exact Mass | 209.03200 |
| PSA | 116.87000 |
| LogP | 1.32860 |
| InChIKey | SJFOSXQPHQXPBA-UHFFFAOYSA-N |
| SMILES | N=C(N[N+](=O)[O-])N(CCCCl)N=O |
| HS Code | 2925290090 |
|---|
|
~%
Guanidine,N-(3-... CAS#:64398-16-9 |
| Literature: Skinner,W.A. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1960 , vol. 2, p. 299 - 333 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-Nitroso-3-nitro-1-<3-chlor-propyl>-guanidin |