4-(aziridin-1-yl)-6-chloro-N-(4-chlorophenyl)pyrimidin-2-amine structure
|
Common Name | 4-(aziridin-1-yl)-6-chloro-N-(4-chlorophenyl)pyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 64398-22-7 | Molecular Weight | 281.14100 | |
| Density | 1.52g/cm3 | Boiling Point | 484.9ºC at 760mmHg | |
| Molecular Formula | C12H10Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1ºC | |
| Name | 4-(aziridin-1-yl)-6-chloro-N-(4-chlorophenyl)pyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 484.9ºC at 760mmHg |
| Molecular Formula | C12H10Cl2N4 |
| Molecular Weight | 281.14100 |
| Flash Point | 247.1ºC |
| Exact Mass | 280.02800 |
| PSA | 40.82000 |
| LogP | 3.48500 |
| Index of Refraction | 1.714 |
| InChIKey | VWMJYUMCUHALPX-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2nc(Cl)cc(N3CC3)n2)cc1 |
|
~%
4-(aziridin-1-y... CAS#:64398-22-7 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-Aziridino-4-chloro-2-p-chloranilinopyrimidine |
| 4-Chloro-6-ethyleneimino-2-p-chloranilinopyrimidine |