(2Z)-2-Cycloocten-1-yl(triethoxy)silane
Modify Date: 2025-09-18 16:57:28
(2Z)-2-Cycloocten-1-yl(triethoxy)silane structure
|
Common Name | (2Z)-2-Cycloocten-1-yl(triethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 64407-06-3 | Molecular Weight | 272.45600 | |
| Density | 0.94g/cm3 | Boiling Point | 310.6ºC at 760 mmHg | |
| Molecular Formula | C14H28O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.8ºC | |
| Name | (2Z)-2-Cycloocten-1-yl(triethoxy)silane |
|---|
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 310.6ºC at 760 mmHg |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.45600 |
| Flash Point | 142.8ºC |
| Exact Mass | 272.18100 |
| PSA | 27.69000 |
| LogP | 3.92530 |
| Index of Refraction | 1.456 |
| InChIKey | BXOPMKPLUPVGHD-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)C1C=CCCCCC1 |
|
~%
(2Z)-2-Cyclooct... CAS#:64407-06-3 |
| Literature: Cornish,A.J. et al. Journal of Organometallic Chemistry, 1977 , vol. 136, p. 73 - 85 |
