methyl 2,2-bis(propan-2-yloxycarbothioylsulfanyl)acetate structure
|
Common Name | methyl 2,2-bis(propan-2-yloxycarbothioylsulfanyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 64407-81-4 | Molecular Weight | 342.51800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,2-bis(propan-2-yloxycarbothioylsulfanyl)acetate |
|---|
| Molecular Formula | C11H18O4S4 |
|---|---|
| Molecular Weight | 342.51800 |
| Exact Mass | 342.00900 |
| PSA | 159.54000 |
| LogP | 3.37170 |
| InChIKey | XEDQSKWELBUIIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(SC(=S)OC(C)C)SC(=S)OC(C)C |
|
~%
methyl 2,2-bis(... CAS#:64407-81-4 |
| Literature: Schumaker,R.R.; Engler,E.M. Journal of the American Chemical Society, 1977 , vol. 99, p. 5521 - 5522 |
|
~%
methyl 2,2-bis(... CAS#:64407-81-4 |
| Literature: Schumaker, R. R.; Lee, V. Y.; Engler, E. M. Journal of Organic Chemistry, 1984 , vol. 49, p. 564 - 566 |