b-L-Arabinopyranoside, methyl3,4-O-(1-methylethylidene)-, S-methyl carbonodithioate(9CI) structure
|
Common Name | b-L-Arabinopyranoside, methyl3,4-O-(1-methylethylidene)-, S-methyl carbonodithioate(9CI) | ||
|---|---|---|---|---|
| CAS Number | 64429-69-2 | Molecular Weight | 294.38800 | |
| Density | 1.3g/cm3 | Boiling Point | 389.3ºC at 760mmHg | |
| Molecular Formula | C11H18O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | O-(6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl) methylsulfanylmethanethioate |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760mmHg |
| Molecular Formula | C11H18O5S2 |
| Molecular Weight | 294.38800 |
| Flash Point | 189.2ºC |
| Exact Mass | 294.06000 |
| PSA | 103.54000 |
| LogP | 1.54230 |
| Index of Refraction | 1.555 |
| InChIKey | DSOIYSHTYHMDGW-UHFFFAOYSA-N |
| SMILES | COC1OCC2OC(C)(C)OC2C1OC(=S)SC |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|