Benzeneacetonitrile,4-methoxy-a-[(4-methoxyphenyl)methylene]- structure
|
Common Name | Benzeneacetonitrile,4-methoxy-a-[(4-methoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 6443-74-9 | Molecular Weight | 265.30700 | |
| Density | 1.134g/cm3 | Boiling Point | 432.1ºC at 760 mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.6ºC | |
| Name | 2,3-bis(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760 mmHg |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 154.6ºC |
| Exact Mass | 265.11000 |
| PSA | 42.25000 |
| LogP | 3.76798 |
| Index of Refraction | 1.601 |
| InChIKey | GGSJIARERFIGST-RVDMUPIBSA-N |
| SMILES | COc1ccc(C=C(C#N)c2ccc(OC)cc2)cc1 |
|
~92%
Benzeneacetonit... CAS#:6443-74-9 |
| Literature: Reddy, M. Parameswara; Rao, G. S. Krishna Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2662 - 2665 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| p-Methoxy-acetophenon-pinacol |
| 2.3-Bis-<4-methoxy-phenyl>-acrylnitril |
| 2,3-bis(4-methoxyphenyl)-2,3-butanediol |
| 2,3-Di-(4-methoxyphenyl)-acrylnitril |
| 2,3-Butanediol,2,3-bis(4-methoxyphenyl) |